C22H42O2 — CID 163205845
(3Z)-14,14-dibutoxytetradeca-1,3-diene (PubChem CID 163205845) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is (3Z)-14,14-dibutoxytetradeca-1,3-diene.
| Compound Name | (3Z)-14,14-dibutoxytetradeca-1,3-diene |
|---|---|
| PubChem CID | 163205845 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | (3Z)-14,14-dibutoxytetradeca-1,3-diene |
| SMILES | C=C/C=C\CCCCCCCCCC(OCCCC)OCCCC |
| InChI | InChI=1S/C22H42O2/c1-4-7-10-11-12-13-14-15-16-17-18-19-22(23-20-8-5-2)24-21-9-6-3/h4,7,10,22H,1,5-6,8-9,11-21H2,2-3H3/b10-7- |
| InChIKey | LBNXYTHEEDUTFZ-YFHOEESVSA-N |
| XLogP | 7.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|