C26H50O2 — CID 170561608
(5Z,7E)-1,1-diheptoxydodeca-5,7-diene (PubChem CID 170561608) has the molecular formula C26H50O2 and a molecular weight of 394.68 g/mol. Its IUPAC name is (5Z,7E)-1,1-diheptoxydodeca-5,7-diene.
| Compound Name | (5Z,7E)-1,1-diheptoxydodeca-5,7-diene |
|---|---|
| PubChem CID | 170561608 |
| Molecular Formula | C26H50O2 |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.38 |
| IUPAC Name | (5Z,7E)-1,1-diheptoxydodeca-5,7-diene |
| SMILES | CCCC/C=C/C=C\CCCC(OCCCCCCC)OCCCCCCC |
| InChI | InChI=1S/C26H50O2/c1-4-7-10-13-14-15-16-17-20-23-26(27-24-21-18-11-8-5-2)28-25-22-19-12-9-6-3/h13-16,26H,4-12,17-25H2,1-3H3/b14-13+,16-15- |
| InChIKey | RUDIQHMYSVHKIO-MSBKQZQESA-N |
| XLogP | 8.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|