C19H36O2 — CID 163205429
(3E)-17,17-dimethoxyheptadeca-1,3-diene (PubChem CID 163205429) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is (3E)-17,17-dimethoxyheptadeca-1,3-diene.
| Compound Name | (3E)-17,17-dimethoxyheptadeca-1,3-diene |
|---|---|
| PubChem CID | 163205429 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | (3E)-17,17-dimethoxyheptadeca-1,3-diene |
| SMILES | C=C/C=C/CCCCCCCCCCCCC(OC)OC |
| InChI | InChI=1S/C19H36O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20-2)21-3/h4-6,19H,1,7-18H2,2-3H3/b6-5+ |
| InChIKey | VPWUCGFOWIPRED-AATRIKPKSA-N |
| XLogP | 6.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|