C15H28 — CID 163546682
11-ethyltrideca-1,3-diene (PubChem CID 163546682) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 11-ethyltrideca-1,3-diene.
| Compound Name | 11-ethyltrideca-1,3-diene |
|---|---|
| PubChem CID | 163546682 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 11-ethyltrideca-1,3-diene |
| SMILES | C=CC=CCCCCCCC(CC)CC |
| InChI | InChI=1S/C15H28/c1-4-7-8-9-10-11-12-13-14-15(5-2)6-3/h4,7-8,15H,1,5-6,9-14H2,2-3H3 |
| InChIKey | FFPIPKRMPVKXIE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|