3-pentyltrideca-10,12-dienoic acid

C18H32O2 — CID 173172715

IUPAC3-pentyltrideca-10,12-dienoic acid
SMILESC=CC=CCCCCCCC(CCCCC)CC(=O)O
InChIInChI=1S/C18H32O2/c1-3-5-7-8-9-10-11-13-15-17(16-18(19)20)14-12-6-4-2/h3,5,7,17H,1,4,6,8-16H2,2H3,(H,19,20)
InChIKeySNUJZAAKQOMMPW-UHFFFAOYSA-N
MW280.45 g/mol
LogP5.74
Rot. Bonds14

About 3-pentyltrideca-10,12-dienoic acid

3-pentyltrideca-10,12-dienoic acid (PubChem CID 173172715) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 3-pentyltrideca-10,12-dienoic acid.

Molecular Properties

Compound Name3-pentyltrideca-10,12-dienoic acid
PubChem CID173172715
Molecular FormulaC18H32O2
Molecular Weight280.45 g/mol
Exact Mass280.24
IUPAC Name3-pentyltrideca-10,12-dienoic acid
SMILESC=CC=CCCCCCCC(CCCCC)CC(=O)O
InChIInChI=1S/C18H32O2/c1-3-5-7-8-9-10-11-13-15-17(16-18(19)20)14-12-6-4-2/h3,5,7,17H,1,4,6,8-16H2,2H3,(H,19,20)
InChIKeySNUJZAAKQOMMPW-UHFFFAOYSA-N
XLogP5.74
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds14
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500280.45
LogP ≤ 55.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 3-pentyltrideca-10,12-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-pentyltrideca-10,12-dienoic acid?
The IUPAC name of 3-pentyltrideca-10,12-dienoic acid (CID 173172715) is 3-pentyltrideca-10,12-dienoic acid.
What is the SMILES notation for 3-pentyltrideca-10,12-dienoic acid?
The canonical SMILES for 3-pentyltrideca-10,12-dienoic acid is C=CC=CCCCCCCC(CCCCC)CC(=O)O.
What is the InChIKey of 3-pentyltrideca-10,12-dienoic acid?
The InChIKey is SNUJZAAKQOMMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2/c1-3-5-7-8-9-10-11-13-15-17(16-18(19)20)14-12-6-4-2/h3,5,7,17H,1,4,6,8-16H2,2H3,(H,19,20).
What are the key properties of 3-pentyltrideca-10,12-dienoic acid?
3-pentyltrideca-10,12-dienoic acid has a molecular weight of 280.45 g/mol, XLogP of 5.74, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyltrideca-10,12-dienoic acid is sourced from PubChem (CID 173172715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).