C18H32O2 — CID 173172715
3-pentyltrideca-10,12-dienoic acid (PubChem CID 173172715) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 3-pentyltrideca-10,12-dienoic acid.
| Compound Name | 3-pentyltrideca-10,12-dienoic acid |
|---|---|
| PubChem CID | 173172715 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 3-pentyltrideca-10,12-dienoic acid |
| SMILES | C=CC=CCCCCCCC(CCCCC)CC(=O)O |
| InChI | InChI=1S/C18H32O2/c1-3-5-7-8-9-10-11-13-15-17(16-18(19)20)14-12-6-4-2/h3,5,7,17H,1,4,6,8-16H2,2H3,(H,19,20) |
| InChIKey | SNUJZAAKQOMMPW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|