C16H28O2 — CID 87988632
3-[(3Z)-hexa-3,5-dienyl]decanoic acid (PubChem CID 87988632) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 3-[(3Z)-hexa-3,5-dienyl]decanoic acid.
| Compound Name | 3-[(3Z)-hexa-3,5-dienyl]decanoic acid |
|---|---|
| PubChem CID | 87988632 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 3-[(3Z)-hexa-3,5-dienyl]decanoic acid |
| SMILES | C=C/C=C\CCC(CCCCCCC)CC(=O)O |
| InChI | InChI=1S/C16H28O2/c1-3-5-7-9-11-13-15(14-16(17)18)12-10-8-6-4-2/h4,6,8,15H,2-3,5,7,9-14H2,1H3,(H,17,18)/b8-6- |
| InChIKey | MBBIGVHNZLTLTK-VURMDHGXSA-N |
| XLogP | 4.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|