C19H34O2 — CID 175937225
2-propylhexadeca-13,15-dienoic acid (PubChem CID 175937225) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 2-propylhexadeca-13,15-dienoic acid.
| Compound Name | 2-propylhexadeca-13,15-dienoic acid |
|---|---|
| PubChem CID | 175937225 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | 2-propylhexadeca-13,15-dienoic acid |
| SMILES | C=CC=CCCCCCCCCCCC(CCC)C(=O)O |
| InChI | InChI=1S/C19H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-17-18(16-4-2)19(20)21/h3,5-6,18H,1,4,7-17H2,2H3,(H,20,21) |
| InChIKey | JQJWXVKQQOHRSX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|