C29H48O2 — CID 123541136
2-propylhexacosa-6,8,10,12,18-pentaenoic acid (PubChem CID 123541136) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 2-propylhexacosa-6,8,10,12,18-pentaenoic acid.
| Compound Name | 2-propylhexacosa-6,8,10,12,18-pentaenoic acid |
|---|---|
| PubChem CID | 123541136 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 2-propylhexacosa-6,8,10,12,18-pentaenoic acid |
| SMILES | CCCCCCCC=CCCCCC=CC=CC=CC=CCCCC(CCC)C(=O)O |
| InChI | InChI=1S/C29H48O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27-28(26-4-2)29(30)31/h10-11,16-23,28H,3-9,12-15,24-27H2,1-2H3,(H,30,31) |
| InChIKey | BEVKPUNNUSPVIH-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|