C10H18O2 — CID 163205415
(3Z)-8,8-dimethoxyocta-1,3-diene (PubChem CID 163205415) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3Z)-8,8-dimethoxyocta-1,3-diene.
| Compound Name | (3Z)-8,8-dimethoxyocta-1,3-diene |
|---|---|
| PubChem CID | 163205415 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3Z)-8,8-dimethoxyocta-1,3-diene |
| SMILES | C=C/C=C\CCCC(OC)OC |
| InChI | InChI=1S/C10H18O2/c1-4-5-6-7-8-9-10(11-2)12-3/h4-6,10H,1,7-9H2,2-3H3/b6-5- |
| InChIKey | WSTRHEIURFIVNJ-WAYWQWQTSA-N |
| XLogP | 2.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|