C8H15IO2 — CID 135030004
(E)-1-iodo-6,6-dimethoxyhex-1-ene (PubChem CID 135030004) has the molecular formula C8H15IO2 and a molecular weight of 270.11 g/mol. Its IUPAC name is (E)-1-iodo-6,6-dimethoxyhex-1-ene.
| Compound Name | (E)-1-iodo-6,6-dimethoxyhex-1-ene |
|---|---|
| PubChem CID | 135030004 |
| Molecular Formula | C8H15IO2 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | (E)-1-iodo-6,6-dimethoxyhex-1-ene |
| SMILES | COC(CCC/C=C/I)OC |
| InChI | InChI=1S/C8H15IO2/c1-10-8(11-2)6-4-3-5-7-9/h5,7-8H,3-4,6H2,1-2H3/b7-5+ |
| InChIKey | VBEMEQITBCJDSL-FNORWQNLSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|