C11H21ClO2 — CID 163205549
(Z)-1-chloro-9,9-dimethoxynon-3-ene (PubChem CID 163205549) has the molecular formula C11H21ClO2 and a molecular weight of 220.74 g/mol. Its IUPAC name is (Z)-1-chloro-9,9-dimethoxynon-3-ene.
| Compound Name | (Z)-1-chloro-9,9-dimethoxynon-3-ene |
|---|---|
| PubChem CID | 163205549 |
| Molecular Formula | C11H21ClO2 |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (Z)-1-chloro-9,9-dimethoxynon-3-ene |
| SMILES | COC(CCCC/C=C\CCCl)OC |
| InChI | InChI=1S/C11H21ClO2/c1-13-11(14-2)9-7-5-3-4-6-8-10-12/h4,6,11H,3,5,7-10H2,1-2H3/b6-4- |
| InChIKey | MVCXNUJFIHUOIF-XQRVVYSFSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|