C8H15ClO2 — CID 163205427
(Z)-6-chloro-1,1-dimethoxyhex-3-ene (PubChem CID 163205427) has the molecular formula C8H15ClO2 and a molecular weight of 178.66 g/mol. Its IUPAC name is (Z)-6-chloro-1,1-dimethoxyhex-3-ene.
| Compound Name | (Z)-6-chloro-1,1-dimethoxyhex-3-ene |
|---|---|
| PubChem CID | 163205427 |
| Molecular Formula | C8H15ClO2 |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (Z)-6-chloro-1,1-dimethoxyhex-3-ene |
| SMILES | COC(C/C=C\CCCl)OC |
| InChI | InChI=1S/C8H15ClO2/c1-10-8(11-2)6-4-3-5-7-9/h3-4,8H,5-7H2,1-2H3/b4-3- |
| InChIKey | HRDMTHFZOKIRLO-ARJAWSKDSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|