C19H30O2 — CID 102155570
(2Z,5Z,8Z,11Z,14Z)-17,17-dimethoxyheptadeca-2,5,8,11,14-pentaene (PubChem CID 102155570) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (2Z,5Z,8Z,11Z,14Z)-17,17-dimethoxyheptadeca-2,5,8,11,14-pentaene.
| Compound Name | (2Z,5Z,8Z,11Z,14Z)-17,17-dimethoxyheptadeca-2,5,8,11,14-pentaene |
|---|---|
| PubChem CID | 102155570 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2Z,5Z,8Z,11Z,14Z)-17,17-dimethoxyheptadeca-2,5,8,11,14-pentaene |
| SMILES | C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(OC)OC |
| InChI | InChI=1S/C19H30O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20-2)21-3/h4-5,7-8,10-11,13-14,16-17,19H,6,9,12,15,18H2,1-3H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | PAZAPHCHWSWSOQ-JEBPEJKESA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|