About ethane;(Z)-5-methoxyhex-2-ene
ethane;(Z)-5-methoxyhex-2-ene (PubChem CID 145378965) has the molecular formula C9H20O
and a molecular weight of 144.26 g/mol. Its IUPAC name is ethane;(Z)-5-methoxyhex-2-ene.
Molecular Properties
| Compound Name | ethane;(Z)-5-methoxyhex-2-ene |
| PubChem CID | 145378965 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | ethane;(Z)-5-methoxyhex-2-ene |
| SMILES | C/C=C\CC(C)OC.CC |
| InChI | InChI=1S/C7H14O.C2H6/c1-4-5-6-7(2)8-3;1-2/h4-5,7H,6H2,1-3H3;1-2H3/b5-4-; |
| InChIKey | HAERKJAKUNPIKK-MKWAYWHRSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-5-methoxyhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-5-methoxyhex-2-ene?
The IUPAC name of ethane;(Z)-5-methoxyhex-2-ene (CID 145378965) is ethane;(Z)-5-methoxyhex-2-ene.
What is the SMILES notation for ethane;(Z)-5-methoxyhex-2-ene?
The canonical SMILES for ethane;(Z)-5-methoxyhex-2-ene is C/C=C\CC(C)OC.CC.
What is the InChIKey of ethane;(Z)-5-methoxyhex-2-ene?
The InChIKey is HAERKJAKUNPIKK-MKWAYWHRSA-N. The full InChI is InChI=1S/C7H14O.C2H6/c1-4-5-6-7(2)8-3;1-2/h4-5,7H,6H2,1-3H3;1-2H3/b5-4-;.
What are the key properties of ethane;(Z)-5-methoxyhex-2-ene?
ethane;(Z)-5-methoxyhex-2-ene has a molecular weight of 144.26 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-5-methoxyhex-2-ene is sourced from PubChem (CID 145378965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).