About (3S,5Z)-3-methylhepta-1,5-diene
(3S,5Z)-3-methylhepta-1,5-diene (PubChem CID 24884419) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is (3S,5Z)-3-methylhepta-1,5-diene.
Molecular Properties
| Compound Name | (3S,5Z)-3-methylhepta-1,5-diene |
| PubChem CID | 24884419 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | (3S,5Z)-3-methylhepta-1,5-diene |
| SMILES | C=C[C@@H](C)C/C=C\C |
| InChI | InChI=1S/C8H14/c1-4-6-7-8(3)5-2/h4-6,8H,2,7H2,1,3H3/b6-4-/t8-/m1/s1 |
| InChIKey | QIWJMWAOAINRPL-RZAAKKIOSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,5Z)-3-methylhepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5Z)-3-methylhepta-1,5-diene?
The IUPAC name of (3S,5Z)-3-methylhepta-1,5-diene (CID 24884419) is (3S,5Z)-3-methylhepta-1,5-diene.
What is the SMILES notation for (3S,5Z)-3-methylhepta-1,5-diene?
The canonical SMILES for (3S,5Z)-3-methylhepta-1,5-diene is C=C[C@@H](C)C/C=C\C.
What is the InChIKey of (3S,5Z)-3-methylhepta-1,5-diene?
The InChIKey is QIWJMWAOAINRPL-RZAAKKIOSA-N. The full InChI is InChI=1S/C8H14/c1-4-6-7-8(3)5-2/h4-6,8H,2,7H2,1,3H3/b6-4-/t8-/m1/s1.
What are the key properties of (3S,5Z)-3-methylhepta-1,5-diene?
(3S,5Z)-3-methylhepta-1,5-diene has a molecular weight of 110.20 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5Z)-3-methylhepta-1,5-diene is sourced from PubChem (CID 24884419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).