C8H14 — CID 24884419
(3S,5Z)-3-methylhepta-1,5-diene (PubChem CID 24884419) has the molecular formula C8H14 and a molecular weight of 110.20 g/mol. Its IUPAC name is (3S,5Z)-3-methylhepta-1,5-diene.
| Compound Name | (3S,5Z)-3-methylhepta-1,5-diene |
|---|---|
| PubChem CID | 24884419 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | (3S,5Z)-3-methylhepta-1,5-diene |
| SMILES | C=C[C@@H](C)C/C=C\C |
| InChI | InChI=1S/C8H14/c1-4-6-7-8(3)5-2/h4-6,8H,2,7H2,1,3H3/b6-4-/t8-/m1/s1 |
| InChIKey | QIWJMWAOAINRPL-RZAAKKIOSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|