C10H16 — CID 142930221
(5Z,7Z)-3-methylnona-1,5,7-triene (PubChem CID 142930221) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (5Z,7Z)-3-methylnona-1,5,7-triene.
| Compound Name | (5Z,7Z)-3-methylnona-1,5,7-triene |
|---|---|
| PubChem CID | 142930221 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (5Z,7Z)-3-methylnona-1,5,7-triene |
| SMILES | C=CC(C)C/C=C\C=C/C |
| InChI | InChI=1S/C10H16/c1-4-6-7-8-9-10(3)5-2/h4-8,10H,2,9H2,1,3H3/b6-4-,8-7- |
| InChIKey | VSWGZMGGGGPYNJ-MOIRPGTBSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|