C21H32O6 — CID 175464511
6-(carboxymethyl)-3-ethenyl-9-hexa-2,4-dienylundecanedioic acid (PubChem CID 175464511) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 6-(carboxymethyl)-3-ethenyl-9-hexa-2,4-dienylundecanedioic acid.
| Compound Name | 6-(carboxymethyl)-3-ethenyl-9-hexa-2,4-dienylundecanedioic acid |
|---|---|
| PubChem CID | 175464511 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 6-(carboxymethyl)-3-ethenyl-9-hexa-2,4-dienylundecanedioic acid |
| SMILES | C=CC(CCC(CCC(CC=CC=CC)CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C21H32O6/c1-3-5-6-7-8-17(14-20(24)25)11-12-18(15-21(26)27)10-9-16(4-2)13-19(22)23/h3-7,16-18H,2,8-15H2,1H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | PVWOCDLWYRUSFS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|