C13H24 — CID 155725646
(2Z,4Z)-7-propyldeca-2,4-diene (PubChem CID 155725646) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is (2Z,4Z)-7-propyldeca-2,4-diene.
| Compound Name | (2Z,4Z)-7-propyldeca-2,4-diene |
|---|---|
| PubChem CID | 155725646 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (2Z,4Z)-7-propyldeca-2,4-diene |
| SMILES | C/C=C\C=C/CC(CCC)CCC |
| InChI | InChI=1S/C13H24/c1-4-7-8-9-12-13(10-5-2)11-6-3/h4,7-9,13H,5-6,10-12H2,1-3H3/b7-4-,9-8- |
| InChIKey | LCUHEXSLHNBKAH-UHWGBUKQSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|