C9H16 — CID 519923
7-methylocta-2,4-diene (PubChem CID 519923) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is 7-methylocta-2,4-diene.
| Compound Name | 7-methylocta-2,4-diene |
|---|---|
| PubChem CID | 519923 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 7-methylocta-2,4-diene |
| SMILES | CC=CC=CCC(C)C |
| InChI | InChI=1S/C9H16/c1-4-5-6-7-8-9(2)3/h4-7,9H,8H2,1-3H3 |
| InChIKey | LLCIDQNOIXWXCW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|