About hexa-2,4-dienyl(propan-2-yl)phosphane
hexa-2,4-dienyl(propan-2-yl)phosphane (PubChem CID 141408930) has the molecular formula C9H17P
and a molecular weight of 156.21 g/mol. Its IUPAC name is hexa-2,4-dienyl(propan-2-yl)phosphane.
Molecular Properties
| Compound Name | hexa-2,4-dienyl(propan-2-yl)phosphane |
| PubChem CID | 141408930 |
| Molecular Formula | C9H17P |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | hexa-2,4-dienyl(propan-2-yl)phosphane |
| SMILES | CC=CC=CCPC(C)C |
| InChI | InChI=1S/C9H17P/c1-4-5-6-7-8-10-9(2)3/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | IJTPNGZTEHWHAR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-2,4-dienyl(propan-2-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-2,4-dienyl(propan-2-yl)phosphane?
The IUPAC name of hexa-2,4-dienyl(propan-2-yl)phosphane (CID 141408930) is hexa-2,4-dienyl(propan-2-yl)phosphane.
What is the SMILES notation for hexa-2,4-dienyl(propan-2-yl)phosphane?
The canonical SMILES for hexa-2,4-dienyl(propan-2-yl)phosphane is CC=CC=CCPC(C)C.
What is the InChIKey of hexa-2,4-dienyl(propan-2-yl)phosphane?
The InChIKey is IJTPNGZTEHWHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17P/c1-4-5-6-7-8-10-9(2)3/h4-7,9-10H,8H2,1-3H3.
What are the key properties of hexa-2,4-dienyl(propan-2-yl)phosphane?
hexa-2,4-dienyl(propan-2-yl)phosphane has a molecular weight of 156.21 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-2,4-dienyl(propan-2-yl)phosphane is sourced from PubChem (CID 141408930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).