C9H13NO — CID 20981678
2-hexa-2,4-dienoxypropanenitrile (PubChem CID 20981678) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-hexa-2,4-dienoxypropanenitrile.
| Compound Name | 2-hexa-2,4-dienoxypropanenitrile |
|---|---|
| PubChem CID | 20981678 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-hexa-2,4-dienoxypropanenitrile |
| SMILES | CC=CC=CCOC(C)C#N |
| InChI | InChI=1S/C9H13NO/c1-3-4-5-6-7-11-9(2)8-10/h3-6,9H,7H2,1-2H3 |
| InChIKey | KXNWTNMHNHZYRK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|