C6H11NO3 — CID 54069244
2-(2,3-dihydroxypropoxy)propanenitrile (PubChem CID 54069244) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)propanenitrile.
| Compound Name | 2-(2,3-dihydroxypropoxy)propanenitrile |
|---|---|
| PubChem CID | 54069244 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-(2,3-dihydroxypropoxy)propanenitrile |
| SMILES | CC(C#N)OCC(O)CO |
| InChI | InChI=1S/C6H11NO3/c1-5(2-7)10-4-6(9)3-8/h5-6,8-9H,3-4H2,1H3 |
| InChIKey | MFFILOCANUCWRD-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |