C10H22O7 — CID 87843229
3-[1-[1-(2,3-dihydroxypropoxy)ethoxy]ethoxy]propane-1,2-diol (PubChem CID 87843229) has the molecular formula C10H22O7 and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-[1-[1-(2,3-dihydroxypropoxy)ethoxy]ethoxy]propane-1,2-diol.
| Compound Name | 3-[1-[1-(2,3-dihydroxypropoxy)ethoxy]ethoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 87843229 |
| Molecular Formula | C10H22O7 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-[1-[1-(2,3-dihydroxypropoxy)ethoxy]ethoxy]propane-1,2-diol |
| SMILES | CC(OCC(O)CO)OC(C)OCC(O)CO |
| InChI | InChI=1S/C10H22O7/c1-7(15-5-9(13)3-11)17-8(2)16-6-10(14)4-12/h7-14H,3-6H2,1-2H3 |
| InChIKey | ZIKCCRAPZNCIQM-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|