C9H21NO4 — CID 129092165
3-[3-(2-aminoethoxy)butan-2-yloxy]propane-1,2-diol (PubChem CID 129092165) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-[3-(2-aminoethoxy)butan-2-yloxy]propane-1,2-diol.
| Compound Name | 3-[3-(2-aminoethoxy)butan-2-yloxy]propane-1,2-diol |
|---|---|
| PubChem CID | 129092165 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 3-[3-(2-aminoethoxy)butan-2-yloxy]propane-1,2-diol |
| SMILES | CC(OCCN)C(C)OCC(O)CO |
| InChI | InChI=1S/C9H21NO4/c1-7(13-4-3-10)8(2)14-6-9(12)5-11/h7-9,11-12H,3-6,10H2,1-2H3 |
| InChIKey | WCLBISGQBFAYFW-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |