About 1-(2-aminoethoxy)ethanol;hydroxylamine
1-(2-aminoethoxy)ethanol;hydroxylamine (PubChem CID 87972798) has the molecular formula C4H14N2O3
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-(2-aminoethoxy)ethanol;hydroxylamine.
Molecular Properties
| Compound Name | 1-(2-aminoethoxy)ethanol;hydroxylamine |
| PubChem CID | 87972798 |
| Molecular Formula | C4H14N2O3 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 1-(2-aminoethoxy)ethanol;hydroxylamine |
| SMILES | CC(O)OCCN.NO |
| InChI | InChI=1S/C4H11NO2.H3NO/c1-4(6)7-3-2-5;1-2/h4,6H,2-3,5H2,1H3;2H,1H2 |
| InChIKey | MLRSUFQEZMAKID-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminoethoxy)ethanol;hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethoxy)ethanol;hydroxylamine?
The IUPAC name of 1-(2-aminoethoxy)ethanol;hydroxylamine (CID 87972798) is 1-(2-aminoethoxy)ethanol;hydroxylamine.
What is the SMILES notation for 1-(2-aminoethoxy)ethanol;hydroxylamine?
The canonical SMILES for 1-(2-aminoethoxy)ethanol;hydroxylamine is CC(O)OCCN.NO.
What is the InChIKey of 1-(2-aminoethoxy)ethanol;hydroxylamine?
The InChIKey is MLRSUFQEZMAKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.H3NO/c1-4(6)7-3-2-5;1-2/h4,6H,2-3,5H2,1H3;2H,1H2.
What are the key properties of 1-(2-aminoethoxy)ethanol;hydroxylamine?
1-(2-aminoethoxy)ethanol;hydroxylamine has a molecular weight of 138.17 g/mol, XLogP of -1.37, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethoxy)ethanol;hydroxylamine is sourced from PubChem (CID 87972798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).