About ethanamine;1-ethoxyethanol
ethanamine;1-ethoxyethanol (PubChem CID 20501270) has the molecular formula C6H17NO2
and a molecular weight of 135.21 g/mol. Its IUPAC name is ethanamine;1-ethoxyethanol.
Molecular Properties
| Compound Name | ethanamine;1-ethoxyethanol |
| PubChem CID | 20501270 |
| Molecular Formula | C6H17NO2 |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.13 |
| IUPAC Name | ethanamine;1-ethoxyethanol |
| SMILES | CCN.CCOC(C)O |
| InChI | InChI=1S/C4H10O2.C2H7N/c1-3-6-4(2)5;1-2-3/h4-5H,3H2,1-2H3;2-3H2,1H3 |
| InChIKey | RPTYDCQZWFFBFM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;1-ethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;1-ethoxyethanol?
The IUPAC name of ethanamine;1-ethoxyethanol (CID 20501270) is ethanamine;1-ethoxyethanol.
What is the SMILES notation for ethanamine;1-ethoxyethanol?
The canonical SMILES for ethanamine;1-ethoxyethanol is CCN.CCOC(C)O.
What is the InChIKey of ethanamine;1-ethoxyethanol?
The InChIKey is RPTYDCQZWFFBFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C2H7N/c1-3-6-4(2)5;1-2-3/h4-5H,3H2,1-2H3;2-3H2,1H3.
What are the key properties of ethanamine;1-ethoxyethanol?
ethanamine;1-ethoxyethanol has a molecular weight of 135.21 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;1-ethoxyethanol is sourced from PubChem (CID 20501270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).