About strontium;1-ethoxyethanol;hydride
strontium;1-ethoxyethanol;hydride (PubChem CID 174472576) has the molecular formula C4H12O2Sr
and a molecular weight of 179.76 g/mol. Its IUPAC name is strontium;1-ethoxyethanol;hydride.
Molecular Properties
| Compound Name | strontium;1-ethoxyethanol;hydride |
| PubChem CID | 174472576 |
| Molecular Formula | C4H12O2Sr |
| Molecular Weight | 179.76 g/mol |
| Exact Mass | 179.99 |
| IUPAC Name | strontium;1-ethoxyethanol;hydride |
| SMILES | CCOC(C)O.[H-].[H-].[Sr+2] |
| InChI | InChI=1S/C4H10O2.Sr.2H/c1-3-6-4(2)5;;;/h4-5H,3H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | XZZOMEFCPXEFHE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.76 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze strontium;1-ethoxyethanol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;1-ethoxyethanol;hydride?
The IUPAC name of strontium;1-ethoxyethanol;hydride (CID 174472576) is strontium;1-ethoxyethanol;hydride.
What is the SMILES notation for strontium;1-ethoxyethanol;hydride?
The canonical SMILES for strontium;1-ethoxyethanol;hydride is CCOC(C)O.[H-].[H-].[Sr+2].
What is the InChIKey of strontium;1-ethoxyethanol;hydride?
The InChIKey is XZZOMEFCPXEFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.Sr.2H/c1-3-6-4(2)5;;;/h4-5H,3H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of strontium;1-ethoxyethanol;hydride?
strontium;1-ethoxyethanol;hydride has a molecular weight of 179.76 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;1-ethoxyethanol;hydride is sourced from PubChem (CID 174472576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).