About 1-ethoxyethanol;oxolane
1-ethoxyethanol;oxolane (PubChem CID 174868802) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is 1-ethoxyethanol;oxolane.
Molecular Properties
| Compound Name | 1-ethoxyethanol;oxolane |
| PubChem CID | 174868802 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 1-ethoxyethanol;oxolane |
| SMILES | C1CCOC1.CCOC(C)O |
| InChI | InChI=1S/C4H10O2.C4H8O/c1-3-6-4(2)5;1-2-4-5-3-1/h4-5H,3H2,1-2H3;1-4H2 |
| InChIKey | ZYVRPTDDICONSJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethanol;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethanol;oxolane?
The IUPAC name of 1-ethoxyethanol;oxolane (CID 174868802) is 1-ethoxyethanol;oxolane.
What is the SMILES notation for 1-ethoxyethanol;oxolane?
The canonical SMILES for 1-ethoxyethanol;oxolane is C1CCOC1.CCOC(C)O.
What is the InChIKey of 1-ethoxyethanol;oxolane?
The InChIKey is ZYVRPTDDICONSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C4H8O/c1-3-6-4(2)5;1-2-4-5-3-1/h4-5H,3H2,1-2H3;1-4H2.
What are the key properties of 1-ethoxyethanol;oxolane?
1-ethoxyethanol;oxolane has a molecular weight of 162.23 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethanol;oxolane is sourced from PubChem (CID 174868802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).