About 1-ethoxyethanol;N-methylmethanamine
1-ethoxyethanol;N-methylmethanamine (PubChem CID 18941772) has the molecular formula C6H17NO2
and a molecular weight of 135.21 g/mol. Its IUPAC name is 1-ethoxyethanol;N-methylmethanamine.
Molecular Properties
| Compound Name | 1-ethoxyethanol;N-methylmethanamine |
| PubChem CID | 18941772 |
| Molecular Formula | C6H17NO2 |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.13 |
| IUPAC Name | 1-ethoxyethanol;N-methylmethanamine |
| SMILES | CCOC(C)O.CNC |
| InChI | InChI=1S/C4H10O2.C2H7N/c1-3-6-4(2)5;1-3-2/h4-5H,3H2,1-2H3;3H,1-2H3 |
| InChIKey | FXQCUYJCODHBNW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethanol;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethanol;N-methylmethanamine?
The IUPAC name of 1-ethoxyethanol;N-methylmethanamine (CID 18941772) is 1-ethoxyethanol;N-methylmethanamine.
What is the SMILES notation for 1-ethoxyethanol;N-methylmethanamine?
The canonical SMILES for 1-ethoxyethanol;N-methylmethanamine is CCOC(C)O.CNC.
What is the InChIKey of 1-ethoxyethanol;N-methylmethanamine?
The InChIKey is FXQCUYJCODHBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C2H7N/c1-3-6-4(2)5;1-3-2/h4-5H,3H2,1-2H3;3H,1-2H3.
What are the key properties of 1-ethoxyethanol;N-methylmethanamine?
1-ethoxyethanol;N-methylmethanamine has a molecular weight of 135.21 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethanol;N-methylmethanamine is sourced from PubChem (CID 18941772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).