About 1-(2-aminoethoxy)ethanol;1-ethoxyethanol
1-(2-aminoethoxy)ethanol;1-ethoxyethanol (PubChem CID 157343406) has the molecular formula C8H21NO4
and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-(2-aminoethoxy)ethanol;1-ethoxyethanol.
Molecular Properties
| Compound Name | 1-(2-aminoethoxy)ethanol;1-ethoxyethanol |
| PubChem CID | 157343406 |
| Molecular Formula | C8H21NO4 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 1-(2-aminoethoxy)ethanol;1-ethoxyethanol |
| SMILES | CC(O)OCCN.CCOC(C)O |
| InChI | InChI=1S/C4H11NO2.C4H10O2/c1-4(6)7-3-2-5;1-3-6-4(2)5/h4,6H,2-3,5H2,1H3;4-5H,3H2,1-2H3 |
| InChIKey | BGRAKBFBQZUGBM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminoethoxy)ethanol;1-ethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethoxy)ethanol;1-ethoxyethanol?
The IUPAC name of 1-(2-aminoethoxy)ethanol;1-ethoxyethanol (CID 157343406) is 1-(2-aminoethoxy)ethanol;1-ethoxyethanol.
What is the SMILES notation for 1-(2-aminoethoxy)ethanol;1-ethoxyethanol?
The canonical SMILES for 1-(2-aminoethoxy)ethanol;1-ethoxyethanol is CC(O)OCCN.CCOC(C)O.
What is the InChIKey of 1-(2-aminoethoxy)ethanol;1-ethoxyethanol?
The InChIKey is BGRAKBFBQZUGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.C4H10O2/c1-4(6)7-3-2-5;1-3-6-4(2)5/h4,6H,2-3,5H2,1H3;4-5H,3H2,1-2H3.
What are the key properties of 1-(2-aminoethoxy)ethanol;1-ethoxyethanol?
1-(2-aminoethoxy)ethanol;1-ethoxyethanol has a molecular weight of 195.26 g/mol, XLogP of -0.34, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethoxy)ethanol;1-ethoxyethanol is sourced from PubChem (CID 157343406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).