About acetamide;1-ethoxyethanol
acetamide;1-ethoxyethanol (PubChem CID 175470032) has the molecular formula C6H15NO3
and a molecular weight of 149.19 g/mol. Its IUPAC name is acetamide;1-ethoxyethanol.
Molecular Properties
| Compound Name | acetamide;1-ethoxyethanol |
| PubChem CID | 175470032 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | acetamide;1-ethoxyethanol |
| SMILES | CC(N)=O.CCOC(C)O |
| InChI | InChI=1S/C4H10O2.C2H5NO/c1-3-6-4(2)5;1-2(3)4/h4-5H,3H2,1-2H3;1H3,(H2,3,4) |
| InChIKey | NMTWCILSRLRABD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetamide;1-ethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;1-ethoxyethanol?
The IUPAC name of acetamide;1-ethoxyethanol (CID 175470032) is acetamide;1-ethoxyethanol.
What is the SMILES notation for acetamide;1-ethoxyethanol?
The canonical SMILES for acetamide;1-ethoxyethanol is CC(N)=O.CCOC(C)O.
What is the InChIKey of acetamide;1-ethoxyethanol?
The InChIKey is NMTWCILSRLRABD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C2H5NO/c1-3-6-4(2)5;1-2(3)4/h4-5H,3H2,1-2H3;1H3,(H2,3,4).
What are the key properties of acetamide;1-ethoxyethanol?
acetamide;1-ethoxyethanol has a molecular weight of 149.19 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;1-ethoxyethanol is sourced from PubChem (CID 175470032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).