C8H21NO2 — CID 90073696
1,1-diethoxyethane;N-methylmethanamine (PubChem CID 90073696) has the molecular formula C8H21NO2 and a molecular weight of 163.26 g/mol. Its IUPAC name is 1,1-diethoxyethane;N-methylmethanamine.
| Compound Name | 1,1-diethoxyethane;N-methylmethanamine |
|---|---|
| PubChem CID | 90073696 |
| Molecular Formula | C8H21NO2 |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.16 |
| IUPAC Name | 1,1-diethoxyethane;N-methylmethanamine |
| SMILES | CCOC(C)OCC.CNC |
| InChI | InChI=1S/C6H14O2.C2H7N/c1-4-7-6(3)8-5-2;1-3-2/h6H,4-5H2,1-3H3;3H,1-2H3 |
| InChIKey | XNWFPIKERSSHNS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|