C10H20O4 — CID 88830026
1,1-diethoxyethane;2-methylpropanedial (PubChem CID 88830026) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,1-diethoxyethane;2-methylpropanedial.
| Compound Name | 1,1-diethoxyethane;2-methylpropanedial |
|---|---|
| PubChem CID | 88830026 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1,1-diethoxyethane;2-methylpropanedial |
| SMILES | CC(C=O)C=O.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.C4H6O2/c1-4-7-6(3)8-5-2;1-4(2-5)3-6/h6H,4-5H2,1-3H3;2-4H,1H3 |
| InChIKey | RGGLWYGTEJBFKY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|