C10H21BrO3 — CID 87787901
2-bromoacetaldehyde;1,1-diethoxyethane;ethene (PubChem CID 87787901) has the molecular formula C10H21BrO3 and a molecular weight of 269.18 g/mol. Its IUPAC name is 2-bromoacetaldehyde;1,1-diethoxyethane;ethene.
| Compound Name | 2-bromoacetaldehyde;1,1-diethoxyethane;ethene |
|---|---|
| PubChem CID | 87787901 |
| Molecular Formula | C10H21BrO3 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-bromoacetaldehyde;1,1-diethoxyethane;ethene |
| SMILES | C=C.CCOC(C)OCC.O=CCBr |
| InChI | InChI=1S/C6H14O2.C2H3BrO.C2H4/c1-4-7-6(3)8-5-2;3-1-2-4;1-2/h6H,4-5H2,1-3H3;2H,1H2;1-2H2 |
| InChIKey | APHVPOADNMOZBP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|