About 2-bromoacetaldehyde;1,1-diethoxyethane;ethene
2-bromoacetaldehyde;1,1-diethoxyethane;ethene (PubChem CID 87787901) has the molecular formula C10H21BrO3
and a molecular weight of 269.18 g/mol. Its IUPAC name is 2-bromoacetaldehyde;1,1-diethoxyethane;ethene.
Molecular Properties
| Compound Name | 2-bromoacetaldehyde;1,1-diethoxyethane;ethene |
| PubChem CID | 87787901 |
| Molecular Formula | C10H21BrO3 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-bromoacetaldehyde;1,1-diethoxyethane;ethene |
| SMILES | C=C.CCOC(C)OCC.O=CCBr |
| InChI | InChI=1S/C6H14O2.C2H3BrO.C2H4/c1-4-7-6(3)8-5-2;3-1-2-4;1-2/h6H,4-5H2,1-3H3;2H,1H2;1-2H2 |
| InChIKey | APHVPOADNMOZBP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoacetaldehyde;1,1-diethoxyethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoacetaldehyde;1,1-diethoxyethane;ethene?
The IUPAC name of 2-bromoacetaldehyde;1,1-diethoxyethane;ethene (CID 87787901) is 2-bromoacetaldehyde;1,1-diethoxyethane;ethene.
What is the SMILES notation for 2-bromoacetaldehyde;1,1-diethoxyethane;ethene?
The canonical SMILES for 2-bromoacetaldehyde;1,1-diethoxyethane;ethene is C=C.CCOC(C)OCC.O=CCBr.
What is the InChIKey of 2-bromoacetaldehyde;1,1-diethoxyethane;ethene?
The InChIKey is APHVPOADNMOZBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C2H3BrO.C2H4/c1-4-7-6(3)8-5-2;3-1-2-4;1-2/h6H,4-5H2,1-3H3;2H,1H2;1-2H2.
What are the key properties of 2-bromoacetaldehyde;1,1-diethoxyethane;ethene?
2-bromoacetaldehyde;1,1-diethoxyethane;ethene has a molecular weight of 269.18 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoacetaldehyde;1,1-diethoxyethane;ethene is sourced from PubChem (CID 87787901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).