C17H39NO3 — CID 88675632
butane;1,1-diethoxyethane;N,N-di(propan-2-yl)formamide (PubChem CID 88675632) has the molecular formula C17H39NO3 and a molecular weight of 305.50 g/mol. Its IUPAC name is butane;1,1-diethoxyethane;N,N-di(propan-2-yl)formamide.
| Compound Name | butane;1,1-diethoxyethane;N,N-di(propan-2-yl)formamide |
|---|---|
| PubChem CID | 88675632 |
| Molecular Formula | C17H39NO3 |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 305.29 |
| IUPAC Name | butane;1,1-diethoxyethane;N,N-di(propan-2-yl)formamide |
| SMILES | CC(C)N(C=O)C(C)C.CCCC.CCOC(C)OCC |
| InChI | InChI=1S/C7H15NO.C6H14O2.C4H10/c1-6(2)8(5-9)7(3)4;1-4-7-6(3)8-5-2;1-3-4-2/h5-7H,1-4H3;6H,4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | GZXXZPDGUKWRRA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|