C6H14O3 — CID 20870845
1-ethoxybutane-1,3-diol (PubChem CID 20870845) has the molecular formula C6H14O3 and a molecular weight of 134.17 g/mol. Its IUPAC name is 1-ethoxybutane-1,3-diol.
| Compound Name | 1-ethoxybutane-1,3-diol |
|---|---|
| PubChem CID | 20870845 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 1-ethoxybutane-1,3-diol |
| SMILES | CCOC(O)CC(C)O |
| InChI | InChI=1S/C6H14O3/c1-3-9-6(8)4-5(2)7/h5-8H,3-4H2,1-2H3 |
| InChIKey | CKESJTPIFYVZDX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|