About 1-ethoxybutane-1,3-diol
1-ethoxybutane-1,3-diol (PubChem CID 20870845) has the molecular formula C6H14O3
and a molecular weight of 134.17 g/mol. Its IUPAC name is 1-ethoxybutane-1,3-diol.
Molecular Properties
| Compound Name | 1-ethoxybutane-1,3-diol |
| PubChem CID | 20870845 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 1-ethoxybutane-1,3-diol |
| SMILES | CCOC(O)CC(C)O |
| InChI | InChI=1S/C6H14O3/c1-3-9-6(8)4-5(2)7/h5-8H,3-4H2,1-2H3 |
| InChIKey | CKESJTPIFYVZDX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxybutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxybutane-1,3-diol?
The IUPAC name of 1-ethoxybutane-1,3-diol (CID 20870845) is 1-ethoxybutane-1,3-diol.
What is the SMILES notation for 1-ethoxybutane-1,3-diol?
The canonical SMILES for 1-ethoxybutane-1,3-diol is CCOC(O)CC(C)O.
What is the InChIKey of 1-ethoxybutane-1,3-diol?
The InChIKey is CKESJTPIFYVZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3/c1-3-9-6(8)4-5(2)7/h5-8H,3-4H2,1-2H3.
What are the key properties of 1-ethoxybutane-1,3-diol?
1-ethoxybutane-1,3-diol has a molecular weight of 134.17 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxybutane-1,3-diol is sourced from PubChem (CID 20870845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).