About palladium;bis(pentane-2,4-diol)
palladium;bis(pentane-2,4-diol) (PubChem CID 58773675) has the molecular formula C10H24O4Pd
and a molecular weight of 314.72 g/mol. Its IUPAC name is palladium;bis(pentane-2,4-diol).
Molecular Properties
| Compound Name | palladium;bis(pentane-2,4-diol) |
| PubChem CID | 58773675 |
| Molecular Formula | C10H24O4Pd |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | palladium;bis(pentane-2,4-diol) |
| SMILES | CC(O)CC(C)O.CC(O)CC(C)O.[Pd] |
| InChI | InChI=1S/2C5H12O2.Pd/c2*1-4(6)3-5(2)7;/h2*4-7H,3H2,1-2H3; |
| InChIKey | CUUGGWKFKJSUCR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze palladium;bis(pentane-2,4-diol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;bis(pentane-2,4-diol)?
The IUPAC name of palladium;bis(pentane-2,4-diol) (CID 58773675) is palladium;bis(pentane-2,4-diol).
What is the SMILES notation for palladium;bis(pentane-2,4-diol)?
The canonical SMILES for palladium;bis(pentane-2,4-diol) is CC(O)CC(C)O.CC(O)CC(C)O.[Pd].
What is the InChIKey of palladium;bis(pentane-2,4-diol)?
The InChIKey is CUUGGWKFKJSUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12O2.Pd/c2*1-4(6)3-5(2)7;/h2*4-7H,3H2,1-2H3;.
What are the key properties of palladium;bis(pentane-2,4-diol)?
palladium;bis(pentane-2,4-diol) has a molecular weight of 314.72 g/mol, XLogP of 0.27, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;bis(pentane-2,4-diol) is sourced from PubChem (CID 58773675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).