About 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol
1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol (PubChem CID 159129228) has the molecular formula C12H35O4P
and a molecular weight of 274.38 g/mol. Its IUPAC name is 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol.
Molecular Properties
| Compound Name | 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol |
| PubChem CID | 159129228 |
| Molecular Formula | C12H35O4P |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol |
| SMILES | C.C.C.CC(O)CC(C)O.CC(O)PC(C)O |
| InChI | InChI=1S/C5H12O2.C4H11O2P.3CH4/c1-4(6)3-5(2)7;1-3(5)7-4(2)6;;;/h4-7H,3H2,1-2H3;3-7H,1-2H3;3*1H4 |
| InChIKey | KGQZTEMTYTUGRW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol?
The IUPAC name of 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol (CID 159129228) is 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol.
What is the SMILES notation for 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol?
The canonical SMILES for 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol is C.C.C.CC(O)CC(C)O.CC(O)PC(C)O.
What is the InChIKey of 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol?
The InChIKey is KGQZTEMTYTUGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H11O2P.3CH4/c1-4(6)3-5(2)7;1-3(5)7-4(2)6;;;/h4-7H,3H2,1-2H3;3-7H,1-2H3;3*1H4.
What are the key properties of 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol?
1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol has a molecular weight of 274.38 g/mol, XLogP of 2.39, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxyethylphosphanyl)ethanol;methane;pentane-2,4-diol is sourced from PubChem (CID 159129228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).