About methane;(2R)-4-methylpentan-2-ol
methane;(2R)-4-methylpentan-2-ol (PubChem CID 159585988) has the molecular formula C7H18O
and a molecular weight of 118.22 g/mol. Its IUPAC name is methane;(2R)-4-methylpentan-2-ol.
Molecular Properties
| Compound Name | methane;(2R)-4-methylpentan-2-ol |
| PubChem CID | 159585988 |
| Molecular Formula | C7H18O |
| Molecular Weight | 118.22 g/mol |
| Exact Mass | 118.14 |
| IUPAC Name | methane;(2R)-4-methylpentan-2-ol |
| SMILES | C.CC(C)C[C@@H](C)O |
| InChI | InChI=1S/C6H14O.CH4/c1-5(2)4-6(3)7;/h5-7H,4H2,1-3H3;1H4/t6-;/m1./s1 |
| InChIKey | MJPUIUNQLUOLSV-FYZOBXCZSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;(2R)-4-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(2R)-4-methylpentan-2-ol?
The IUPAC name of methane;(2R)-4-methylpentan-2-ol (CID 159585988) is methane;(2R)-4-methylpentan-2-ol.
What is the SMILES notation for methane;(2R)-4-methylpentan-2-ol?
The canonical SMILES for methane;(2R)-4-methylpentan-2-ol is C.CC(C)C[C@@H](C)O.
What is the InChIKey of methane;(2R)-4-methylpentan-2-ol?
The InChIKey is MJPUIUNQLUOLSV-FYZOBXCZSA-N. The full InChI is InChI=1S/C6H14O.CH4/c1-5(2)4-6(3)7;/h5-7H,4H2,1-3H3;1H4/t6-;/m1./s1.
What are the key properties of methane;(2R)-4-methylpentan-2-ol?
methane;(2R)-4-methylpentan-2-ol has a molecular weight of 118.22 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(2R)-4-methylpentan-2-ol is sourced from PubChem (CID 159585988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).