About (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane
(2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane (PubChem CID 158186042) has the molecular formula C14H30O
and a molecular weight of 214.39 g/mol. Its IUPAC name is (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane.
Molecular Properties
| Compound Name | (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane |
| PubChem CID | 158186042 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane |
| SMILES | CC(C)C1CCCC1.CC(C)C[C@H](C)O |
| InChI | InChI=1S/C8H16.C6H14O/c1-7(2)8-5-3-4-6-8;1-5(2)4-6(3)7/h7-8H,3-6H2,1-2H3;5-7H,4H2,1-3H3/t;6-/m.0/s1 |
| InChIKey | FZDMJULPARQQAK-ZCMDIHMWSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane?
The IUPAC name of (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane (CID 158186042) is (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane.
What is the SMILES notation for (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane?
The canonical SMILES for (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane is CC(C)C1CCCC1.CC(C)C[C@H](C)O.
What is the InChIKey of (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane?
The InChIKey is FZDMJULPARQQAK-ZCMDIHMWSA-N. The full InChI is InChI=1S/C8H16.C6H14O/c1-7(2)8-5-3-4-6-8;1-5(2)4-6(3)7/h7-8H,3-6H2,1-2H3;5-7H,4H2,1-3H3/t;6-/m.0/s1.
What are the key properties of (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane?
(2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane has a molecular weight of 214.39 g/mol, XLogP of 4.25, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methylpentan-2-ol;propan-2-ylcyclopentane is sourced from PubChem (CID 158186042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).