About ethane;methane;propan-2-ylcyclohexane
ethane;methane;propan-2-ylcyclohexane (PubChem CID 169430642) has the molecular formula C12H28
and a molecular weight of 172.36 g/mol. Its IUPAC name is ethane;methane;propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | ethane;methane;propan-2-ylcyclohexane |
| PubChem CID | 169430642 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | ethane;methane;propan-2-ylcyclohexane |
| SMILES | C.CC.CC(C)C1CCCCC1 |
| InChI | InChI=1S/C9H18.C2H6.CH4/c1-8(2)9-6-4-3-5-7-9;1-2;/h8-9H,3-7H2,1-2H3;1-2H3;1H4 |
| InChIKey | VLYYKHFTZGDUOE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;methane;propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;propan-2-ylcyclohexane?
The IUPAC name of ethane;methane;propan-2-ylcyclohexane (CID 169430642) is ethane;methane;propan-2-ylcyclohexane.
What is the SMILES notation for ethane;methane;propan-2-ylcyclohexane?
The canonical SMILES for ethane;methane;propan-2-ylcyclohexane is C.CC.CC(C)C1CCCCC1.
What is the InChIKey of ethane;methane;propan-2-ylcyclohexane?
The InChIKey is VLYYKHFTZGDUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C2H6.CH4/c1-8(2)9-6-4-3-5-7-9;1-2;/h8-9H,3-7H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;methane;propan-2-ylcyclohexane?
ethane;methane;propan-2-ylcyclohexane has a molecular weight of 172.36 g/mol, XLogP of 4.89, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;propan-2-ylcyclohexane is sourced from PubChem (CID 169430642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).