C19H42 — CID 143562850
ethane;propan-2-ylcyclohexane;2,2,3-trimethylpentane (PubChem CID 143562850) has the molecular formula C19H42 and a molecular weight of 270.55 g/mol. Its IUPAC name is ethane;propan-2-ylcyclohexane;2,2,3-trimethylpentane.
| Compound Name | ethane;propan-2-ylcyclohexane;2,2,3-trimethylpentane |
|---|---|
| PubChem CID | 143562850 |
| Molecular Formula | C19H42 |
| Molecular Weight | 270.55 g/mol |
| Exact Mass | 270.33 |
| IUPAC Name | ethane;propan-2-ylcyclohexane;2,2,3-trimethylpentane |
| SMILES | CC.CC(C)C1CCCCC1.CCC(C)C(C)(C)C |
| InChI | InChI=1S/C9H18.C8H18.C2H6/c1-8(2)9-6-4-3-5-7-9;1-6-7(2)8(3,4)5;1-2/h8-9H,3-7H2,1-2H3;7H,6H2,1-5H3;1-2H3 |
| InChIKey | MIDWXVBYMOXUCD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |