C14H30 — CID 159663996
2,2-dimethylpropane;propan-2-ylcyclohexane (PubChem CID 159663996) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is 2,2-dimethylpropane;propan-2-ylcyclohexane.
| Compound Name | 2,2-dimethylpropane;propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 159663996 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 2,2-dimethylpropane;propan-2-ylcyclohexane |
| SMILES | CC(C)(C)C.CC(C)C1CCCCC1 |
| InChI | InChI=1S/C9H18.C5H12/c1-8(2)9-6-4-3-5-7-9;1-5(2,3)4/h8-9H,3-7H2,1-2H3;1-4H3 |
| InChIKey | MTEAVJUVCBDFPF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |