About propane;propan-2-ylcyclopentane
propane;propan-2-ylcyclopentane (PubChem CID 91615250) has the molecular formula C11H24
and a molecular weight of 156.31 g/mol. Its IUPAC name is propane;propan-2-ylcyclopentane.
Molecular Properties
| Compound Name | propane;propan-2-ylcyclopentane |
| PubChem CID | 91615250 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | propane;propan-2-ylcyclopentane |
| SMILES | CC(C)C1CCCC1.CCC |
| InChI | InChI=1S/C8H16.C3H8/c1-7(2)8-5-3-4-6-8;1-3-2/h7-8H,3-6H2,1-2H3;3H2,1-2H3 |
| InChIKey | GKPBANPMXCVBAP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze propane;propan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;propan-2-ylcyclopentane?
The IUPAC name of propane;propan-2-ylcyclopentane (CID 91615250) is propane;propan-2-ylcyclopentane.
What is the SMILES notation for propane;propan-2-ylcyclopentane?
The canonical SMILES for propane;propan-2-ylcyclopentane is CC(C)C1CCCC1.CCC.
What is the InChIKey of propane;propan-2-ylcyclopentane?
The InChIKey is GKPBANPMXCVBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.C3H8/c1-7(2)8-5-3-4-6-8;1-3-2/h7-8H,3-6H2,1-2H3;3H2,1-2H3.
What are the key properties of propane;propan-2-ylcyclopentane?
propane;propan-2-ylcyclopentane has a molecular weight of 156.31 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propane;propan-2-ylcyclopentane is sourced from PubChem (CID 91615250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).