About 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane
1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane (PubChem CID 159304571) has the molecular formula C29H58
and a molecular weight of 406.78 g/mol. Its IUPAC name is 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane.
Molecular Properties
| Compound Name | 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane |
| PubChem CID | 159304571 |
| Molecular Formula | C29H58 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.45 |
| IUPAC Name | 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane |
| SMILES | CC(C)C1CCCC1.CC(C)C1CCCCCC1.CCC1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C11H22.C10H20.C8H16/c1-4-10-5-7-11(8-6-10)9(2)3;1-9(2)10-7-5-3-4-6-8-10;1-7(2)8-5-3-4-6-8/h9-11H,4-8H2,1-3H3;9-10H,3-8H2,1-2H3;7-8H,3-6H2,1-2H3 |
| InChIKey | LBTIKURXPGZKCL-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane?
The IUPAC name of 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane (CID 159304571) is 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane.
What is the SMILES notation for 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane?
The canonical SMILES for 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane is CC(C)C1CCCC1.CC(C)C1CCCCCC1.CCC1CCC(C(C)C)CC1.
What is the InChIKey of 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane?
The InChIKey is LBTIKURXPGZKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.C10H20.C8H16/c1-4-10-5-7-11(8-6-10)9(2)3;1-9(2)10-7-5-3-4-6-8-10;1-7(2)8-5-3-4-6-8/h9-11H,4-8H2,1-3H3;9-10H,3-8H2,1-2H3;7-8H,3-6H2,1-2H3.
What are the key properties of 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane?
1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane has a molecular weight of 406.78 g/mol, XLogP of 10.30, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-propan-2-ylcyclohexane;propan-2-ylcycloheptane;propan-2-ylcyclopentane is sourced from PubChem (CID 159304571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).