About butan-2-ylcyclohexane;ethane
butan-2-ylcyclohexane;ethane (PubChem CID 143005290) has the molecular formula C14H32
and a molecular weight of 200.41 g/mol. Its IUPAC name is butan-2-ylcyclohexane;ethane.
Molecular Properties
| Compound Name | butan-2-ylcyclohexane;ethane |
| PubChem CID | 143005290 |
| Molecular Formula | C14H32 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.25 |
| IUPAC Name | butan-2-ylcyclohexane;ethane |
| SMILES | CC.CC.CCC(C)C1CCCCC1 |
| InChI | InChI=1S/C10H20.2C2H6/c1-3-9(2)10-7-5-4-6-8-10;2*1-2/h9-10H,3-8H2,1-2H3;2*1-2H3 |
| InChIKey | ATLCLMNRDXDMRV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butan-2-ylcyclohexane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylcyclohexane;ethane?
The IUPAC name of butan-2-ylcyclohexane;ethane (CID 143005290) is butan-2-ylcyclohexane;ethane.
What is the SMILES notation for butan-2-ylcyclohexane;ethane?
The canonical SMILES for butan-2-ylcyclohexane;ethane is CC.CC.CCC(C)C1CCCCC1.
What is the InChIKey of butan-2-ylcyclohexane;ethane?
The InChIKey is ATLCLMNRDXDMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.2C2H6/c1-3-9(2)10-7-5-4-6-8-10;2*1-2/h9-10H,3-8H2,1-2H3;2*1-2H3.
What are the key properties of butan-2-ylcyclohexane;ethane?
butan-2-ylcyclohexane;ethane has a molecular weight of 200.41 g/mol, XLogP of 5.67, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylcyclohexane;ethane is sourced from PubChem (CID 143005290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).