About butane;pentan-2-ylcyclohexane
butane;pentan-2-ylcyclohexane (PubChem CID 143682251) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is butane;pentan-2-ylcyclohexane.
Molecular Properties
| Compound Name | butane;pentan-2-ylcyclohexane |
| PubChem CID | 143682251 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | butane;pentan-2-ylcyclohexane |
| SMILES | CCCC.CCCC(C)C1CCCCC1 |
| InChI | InChI=1S/C11H22.C4H10/c1-3-7-10(2)11-8-5-4-6-9-11;1-3-4-2/h10-11H,3-9H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | QPLJNYLWXKMSIS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;pentan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;pentan-2-ylcyclohexane?
The IUPAC name of butane;pentan-2-ylcyclohexane (CID 143682251) is butane;pentan-2-ylcyclohexane.
What is the SMILES notation for butane;pentan-2-ylcyclohexane?
The canonical SMILES for butane;pentan-2-ylcyclohexane is CCCC.CCCC(C)C1CCCCC1.
What is the InChIKey of butane;pentan-2-ylcyclohexane?
The InChIKey is QPLJNYLWXKMSIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.C4H10/c1-3-7-10(2)11-8-5-4-6-9-11;1-3-4-2/h10-11H,3-9H2,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;pentan-2-ylcyclohexane?
butane;pentan-2-ylcyclohexane has a molecular weight of 212.42 g/mol, XLogP of 5.81, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;pentan-2-ylcyclohexane is sourced from PubChem (CID 143682251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).