About ethane;pentan-2-ylcyclohexane
ethane;pentan-2-ylcyclohexane (PubChem CID 143225886) has the molecular formula C17H40
and a molecular weight of 244.51 g/mol. Its IUPAC name is ethane;pentan-2-ylcyclohexane.
Molecular Properties
| Compound Name | ethane;pentan-2-ylcyclohexane |
| PubChem CID | 143225886 |
| Molecular Formula | C17H40 |
| Molecular Weight | 244.51 g/mol |
| Exact Mass | 244.31 |
| IUPAC Name | ethane;pentan-2-ylcyclohexane |
| SMILES | CC.CC.CC.CCCC(C)C1CCCCC1 |
| InChI | InChI=1S/C11H22.3C2H6/c1-3-7-10(2)11-8-5-4-6-9-11;3*1-2/h10-11H,3-9H2,1-2H3;3*1-2H3 |
| InChIKey | YFSCJBVJMBLQHT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.51 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;pentan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pentan-2-ylcyclohexane?
The IUPAC name of ethane;pentan-2-ylcyclohexane (CID 143225886) is ethane;pentan-2-ylcyclohexane.
What is the SMILES notation for ethane;pentan-2-ylcyclohexane?
The canonical SMILES for ethane;pentan-2-ylcyclohexane is CC.CC.CC.CCCC(C)C1CCCCC1.
What is the InChIKey of ethane;pentan-2-ylcyclohexane?
The InChIKey is YFSCJBVJMBLQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.3C2H6/c1-3-7-10(2)11-8-5-4-6-9-11;3*1-2/h10-11H,3-9H2,1-2H3;3*1-2H3.
What are the key properties of ethane;pentan-2-ylcyclohexane?
ethane;pentan-2-ylcyclohexane has a molecular weight of 244.51 g/mol, XLogP of 7.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pentan-2-ylcyclohexane is sourced from PubChem (CID 143225886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).