About 3-pentan-2-ylazepane
3-pentan-2-ylazepane (PubChem CID 107889859) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is 3-pentan-2-ylazepane.
Molecular Properties
| Compound Name | 3-pentan-2-ylazepane |
| PubChem CID | 107889859 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 3-pentan-2-ylazepane |
| SMILES | CCCC(C)C1CCCCNC1 |
| InChI | InChI=1S/C11H23N/c1-3-6-10(2)11-7-4-5-8-12-9-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | QVNHOXMYBPFAOL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-pentan-2-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentan-2-ylazepane?
The IUPAC name of 3-pentan-2-ylazepane (CID 107889859) is 3-pentan-2-ylazepane.
What is the SMILES notation for 3-pentan-2-ylazepane?
The canonical SMILES for 3-pentan-2-ylazepane is CCCC(C)C1CCCCNC1.
What is the InChIKey of 3-pentan-2-ylazepane?
The InChIKey is QVNHOXMYBPFAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-3-6-10(2)11-7-4-5-8-12-9-11/h10-12H,3-9H2,1-2H3.
What are the key properties of 3-pentan-2-ylazepane?
3-pentan-2-ylazepane has a molecular weight of 169.31 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentan-2-ylazepane is sourced from PubChem (CID 107889859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).