About 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane
1-(azacyclododec-3-yl)ethanamine;tripropoxysilane (PubChem CID 173123595) has the molecular formula C22H50N2O3Si
and a molecular weight of 418.74 g/mol. Its IUPAC name is 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane.
Molecular Properties
| Compound Name | 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane |
| PubChem CID | 173123595 |
| Molecular Formula | C22H50N2O3Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane |
| SMILES | CC(N)C1CCCCCCCCCNC1.CCCO[SiH](OCCC)OCCC |
| InChI | InChI=1S/C13H28N2.C9H22O3Si/c1-12(14)13-9-7-5-3-2-4-6-8-10-15-11-13;1-4-7-10-13(11-8-5-2)12-9-6-3/h12-13,15H,2-11,14H2,1H3;13H,4-9H2,1-3H3 |
| InChIKey | YBQYZIYULKSTQW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane?
The IUPAC name of 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane (CID 173123595) is 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane.
What is the SMILES notation for 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane?
The canonical SMILES for 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane is CC(N)C1CCCCCCCCCNC1.CCCO[SiH](OCCC)OCCC.
What is the InChIKey of 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane?
The InChIKey is YBQYZIYULKSTQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2.C9H22O3Si/c1-12(14)13-9-7-5-3-2-4-6-8-10-15-11-13;1-4-7-10-13(11-8-5-2)12-9-6-3/h12-13,15H,2-11,14H2,1H3;13H,4-9H2,1-3H3.
What are the key properties of 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane?
1-(azacyclododec-3-yl)ethanamine;tripropoxysilane has a molecular weight of 418.74 g/mol, XLogP of 4.66, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azacyclododec-3-yl)ethanamine;tripropoxysilane is sourced from PubChem (CID 173123595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).